* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AM UB 0029 |
| EnglishSynonyms: | RARECHEM AM UB 0029 |
| pro_mdlNumber: | MFCD01850888 |
| pro_acceptors: | 2 |
| pro_donors: | 1 |
| pro_smile: | c1ccc(cc1)C(C#CCN2CCCC2)(c3ccccc3Cl)O |
| InChi: | InChI=1S/C20H20ClNO/c21-19-12-5-4-11-18(19)20(23,17-9-2-1-3-10-17)13-8-16-22-14-6-7-15-22/h1-5,9-12,23H,6-7,14-16H2 |
| InChiKey: | InChIKey=FUERHIFBDWTBRC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.