* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AM UB 008N |
| EnglishSynonyms: | RARECHEM AM UB 008N |
| pro_mdlNumber: | MFCD01850901 |
| pro_acceptors: | 5 |
| pro_donors: | 0 |
| pro_smile: | COc1ccc(cc1)C2S(=O)(=O)CCCS2(=O)=O |
| InChi: | InChI=1S/C11H14O5S2/c1-16-10-5-3-9(4-6-10)11-17(12,13)7-2-8-18(11,14)15/h3-6,11H,2,7-8H2,1H3 |
| InChiKey: | InChIKey=HHCWZRVGGOOORY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.