* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AP KA 0081 |
| EnglishSynonyms: | RARECHEM AP KA 0081 |
| pro_mdlNumber: | MFCD01850981 |
| pro_acceptors: | 6 |
| pro_donors: | 3 |
| pro_smile: | c1ccc(cc1)COc2cccc(c2)CC(C(=O)O)NC(=O)N |
| InChi: | InChI=1S/C17H18N2O4/c18-17(22)19-15(16(20)21)10-13-7-4-8-14(9-13)23-11-12-5-2-1-3-6-12/h1-9,15H,10-11H2,(H,20,21)(H3,18,19,22) |
| InChiKey: | InChIKey=KLCCMGQTFPDMTR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.