* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AP KH 0153 |
| EnglishSynonyms: | RARECHEM AP KH 0153 |
| pro_mdlNumber: | MFCD01851047 |
| pro_acceptors: | 5 |
| pro_donors: | 3 |
| pro_smile: | c1cc([nH]c1)/C=C\2/C(=O)NC(=O)N2 |
| InChi: | InChI=1S/C8H7N3O2/c12-7-6(10-8(13)11-7)4-5-2-1-3-9-5/h1-4,9H,(H2,10,11,12,13)/b6-4- |
| InChiKey: | InChIKey=CFKHSFBDILYDDW-XQRVVYSFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.