* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM FH 10 0A11 |
| EnglishSynonyms: | RARECHEM FH 10 0A11 |
| pro_mdlNumber: | MFCD01851144 |
| pro_acceptors: | 6 |
| pro_donors: | 2 |
| pro_smile: | c1ccc(cc1)C(=O)c2ccccc2N(c3ccccc3C(=O)O)c4ccccc4C(=O)O |
| InChi: | InChI=1S/C27H19NO5/c29-25(18-10-2-1-3-11-18)19-12-4-7-15-22(19)28(23-16-8-5-13-20(23)26(30)31)24-17-9-6-14-21(24)27(32)33/h1-17H,(H,30,31)(H,32,33) |
| InChiKey: | InChIKey=OCWRYSIQZXBTGU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.