* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM FH 10 S107 |
| EnglishSynonyms: | RARECHEM FH 10 S107 |
| pro_mdlNumber: | MFCD01851159 |
| pro_acceptors: | 3 |
| pro_donors: | 1 |
| pro_smile: | CC1C(CC2CC1C2(C)C)C(=O)Nc3ccc4c(c3)C(c5cccc6c5N4c7ccccc7C6(C)C)(C)C |
| InChi: | InChI=1S/C35H40N2O/c1-20-23(17-21-18-27(20)33(21,2)3)32(38)36-22-15-16-30-28(19-22)35(6,7)26-13-10-12-25-31(26)37(30)29-14-9-8-11-24(29)34(25,4)5/h8-16,19-21,23,27H,17-18H2,1-7H3,(H,36,38) |
| InChiKey: | InChIKey=DOFRMJAKMJQTAD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.