* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM FH 1B 0108 |
| EnglishSynonyms: | RARECHEM FH 1B 0108 |
| pro_mdlNumber: | MFCD01851200 |
| pro_acceptors: | 2 |
| pro_donors: | 0 |
| pro_smile: | Cc1ccc(c(c1)Br)N(C)C(=O)C(C)(C)C |
| InChi: | InChI=1S/C13H18BrNO/c1-9-6-7-11(10(14)8-9)15(5)12(16)13(2,3)4/h6-8H,1-5H3 |
| InChiKey: | InChIKey=UGBQHUQFGRVQHV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.