* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | FCHGROUP FCH845030 |
| EnglishSynonyms: | FCHGROUP FCH845030 ; RARECHEM AK MA K048 |
| pro_mdlNumber: | MFCD01860791 |
| pro_acceptors: | 2 |
| pro_donors: | 0 |
| pro_smile: | c1ccc2c(c1)c3c(o2)C(=O)CCC3 |
| InChi: | InChI=1S/C12H10O2/c13-10-6-3-5-9-8-4-1-2-7-11(8)14-12(9)10/h1-2,4,7H,3,5-6H2 |
| InChiKey: | InChIKey=VUPILRSAWMNLCE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.