* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AM UA 0001 |
| EnglishSynonyms: | RARECHEM AM UA 0001 |
| pro_mdlNumber: | MFCD02258211 |
| pro_acceptors: | 5 |
| pro_donors: | 1 |
| pro_smile: | CN1C(=O)C(NS1(=O)=O)c2ccccc2 |
| InChi: | InChI=1S/C9H10N2O3S/c1-11-9(12)8(10-15(11,13)14)7-5-3-2-4-6-7/h2-6,8,10H,1H3 |
| InChiKey: | InChIKey=GEOKJMIUVDWCNQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.