* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AM UB 0184 |
| EnglishSynonyms: | RARECHEM AM UB 0184 |
| pro_mdlNumber: | MFCD02258215 |
| pro_acceptors: | 5 |
| pro_donors: | 1 |
| pro_smile: | CC1(C(=O)N(S(=O)(=O)N1)C(c2ccccc2)c3ccccc3)C.O |
| InChi: | InChI=1S/C17H18N2O3S.H2O/c1-17(2)16(20)19(23(21,22)18-17)15(13-9-5-3-6-10-13)14-11-7-4-8-12-14;/h3-12,15,18H,1-2H3;1H2 |
| InChiKey: | InChIKey=BWBZQQATBALJQC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.