* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AM UC 0404 |
| EnglishSynonyms: | RARECHEM AM UC 0404 |
| pro_mdlNumber: | MFCD02258249 |
| pro_acceptors: | 7 |
| pro_donors: | 2 |
| pro_smile: | CC1(C(=O)N(S(=O)(=O)N1)CCC(=O)O)C |
| InChi: | InChI=1S/C7H12N2O5S/c1-7(2)6(12)9(4-3-5(10)11)15(13,14)8-7/h8H,3-4H2,1-2H3,(H,10,11) |
| InChiKey: | InChIKey=HOOVJLLAKYOKEO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.