* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | TRICHOTHEC-9-ENE-3,4,15-TRIOL, 12,13-EPOXY-, 3-ACETATE, (3ALPHA,4BETA)- |
| CAS: | 70402-13-0 |
| EnglishSynonyms: | TRICHOTHEC-9-ENE-3,4,15-TRIOL, 12,13-EPOXY-, 3-ACETATE, (3ALPHA,4BETA)- |
| pro_mdlNumber: | MFCD02314050 |
| pro_acceptors: | 6 |
| pro_donors: | 2 |
| pro_smile: | CC1=C[C@@H]2[C@](CC1)([C@]3([C@@H]([C@H]([C@H]([C@@]34CO4)O2)OC(=O)C)O)C)CO |
| InChi: | InChI=1S/C17H24O6/c1-9-4-5-16(7-18)11(6-9)23-14-12(22-10(2)19)13(20)15(16,3)17(14)8-21-17/h6,11-14,18,20H,4-5,7-8H2,1-3H3/t11-,12-,13-,14-,15-,16-,17+/m1/s1 |
| InChiKey: | InChIKey=NFFRTZSZVQIMDJ-OINWIYPRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.