* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM DK HW 0179 |
| EnglishSynonyms: | RARECHEM DK HW 0179 |
| pro_mdlNumber: | MFCD03003496 |
| pro_acceptors: | 4 |
| pro_donors: | 2 |
| pro_smile: | c1cc(c(c(c1CC(C(=O)O)C(=O)O)F)F)C(F)(F)F |
| InChi: | InChI=1S/C11H7F5O4/c12-7-4(3-5(9(17)18)10(19)20)1-2-6(8(7)13)11(14,15)16/h1-2,5H,3H2,(H,17,18)(H,19,20) |
| InChiKey: | InChIKey=KLFOWIDEOGMQKQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.