* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | FCHGROUP FCH1335006 |
| EnglishSynonyms: | FCHGROUP FCH1335006 ; RARECHEM AM UF SCH9 |
| pro_mdlNumber: | MFCD03412971 |
| pro_acceptors: | 5 |
| pro_donors: | 1 |
| pro_smile: | CN1C(=O)C2(CCSCC2)NS1(=O)=O |
| InChi: | InChI=1S/C7H12N2O3S2/c1-9-6(10)7(8-14(9,11)12)2-4-13-5-3-7/h8H,2-5H2,1H3 |
| InChiKey: | InChIKey=YZIXNMDWTVNEGF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.