* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | FCHGROUP FCH1335009 |
| EnglishSynonyms: | RARECHEM AM UG B253 ; FCHGROUP FCH1335009 |
| pro_mdlNumber: | MFCD03412980 |
| pro_acceptors: | 2 |
| pro_donors: | 1 |
| pro_smile: | CC(C)C/C(=N/O)/C=C/c1cccs1 |
| InChi: | InChI=1S/C11H15NOS/c1-9(2)8-10(12-13)5-6-11-4-3-7-14-11/h3-7,9,13H,8H2,1-2H3/b6-5+,12-10+ |
| InChiKey: | InChIKey=HEPJACAGJUUTLZ-VTNGQZISSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.