* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | FCHGROUP FCH847414 |
EnglishSynonyms: | RARECHEM AQ A2 0003 ; FCHGROUP FCH847414 |
pro_mdlNumber: | MFCD03413021 |
pro_acceptors: | 2 |
pro_donors: | 0 |
pro_smile: | C/C(=C\[O-])/C=O.[Na+] |
InChi: | InChI=1S/C4H6O2.Na/c1-4(2-5)3-6;/h2-3,5H,1H3;/q;+1/p-1/b4-2+; |
InChiKey: | InChIKey=NFIADFIYRQBJQN-VEELZWTKSA-M |
* If the product has intellectual property rights, a license granted is must or contact us.