* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | FCHGROUP FCH847416 |
| EnglishSynonyms: | RARECHEM AQ A2 0005 ; FCHGROUP FCH847416 |
| pro_mdlNumber: | MFCD03413023 |
| pro_acceptors: | 2 |
| pro_donors: | 0 |
| pro_smile: | c1ccc(cc1)/C(=C\[O-])/C=O.[Na+] |
| InChi: | InChI=1S/C9H8O2.Na/c10-6-9(7-11)8-4-2-1-3-5-8;/h1-7,10H;/q;+1/p-1/b9-6-; |
| InChiKey: | InChIKey=BUCFHQGVETZMHQ-BORNJIKYSA-M |
* If the product has intellectual property rights, a license granted is must or contact us.