* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | GW 5074 |
| CAS: | 220904-83-6 |
| EnglishSynonyms: | GW 5074 ; GW5074 ; 3-(3,5-DIBROMO-4-HYDROXYBENZYLIDEN)-5-IODO-1,3-DIHYDROINDOL-2-ONE |
| pro_mdlNumber: | MFCD03453076 |
| pro_acceptors: | 3 |
| pro_donors: | 2 |
| pro_smile: | c1cc2c(cc1I)/C(=C\c3cc(c(c(c3)Br)O)Br)/C(=O)N2 |
| InChi: | InChI=1S/C15H8Br2INO2/c16-11-4-7(5-12(17)14(11)20)3-10-9-6-8(18)1-2-13(9)19-15(10)21/h1-6,20H,(H,19,21)/b10-3+ |
| InChiKey: | InChIKey=LMXYVLFTZRPNRV-XCVCLJGOSA-N |
|
|
|
|
| secure_wgk_germany: | 3 |
* If the product has intellectual property rights, a license granted is must or contact us.