* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | GLYCOLIC ACID-1-13C |
| EnglishSynonyms: | GLYCOLIC ACID-1-13C ; HYDROXYACETIC ACID-1-13C |
| pro_mdlNumber: | MFCD04118145 |
| pro_acceptors: | 3 |
| pro_donors: | 2 |
| pro_smile: | C([13C](=O)O)O |
| InChi: | InChI=1S/C2H4O3/c3-1-2(4)5/h3H,1H2,(H,4,5)/i2+1 |
| InChiKey: | InChIKey=AEMRFAOFKBGASW-VQEHIDDOSA-N |
|
|
| Comments: | MASS SHIFT: M+1 |
| Information: | ISOTOPIC PURITY: 99 ATOM % 13C MW: 77.04 BY ATOM % CALCULATION |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.