* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | DL-HOMOCYSTINE-1,1'-13C2 |
EnglishSynonyms: | DL-HOMOCYSTINE-1,1'-13C2 |
pro_mdlNumber: | MFCD04118174 |
pro_acceptors: | 6 |
pro_donors: | 4 |
pro_smile: | C(CSSCCC([13C](=O)O)N)C([13C](=O)O)N |
InChi: | InChI=1S/C8H16N2O4S2/c9-5(7(11)12)1-3-15-16-4-2-6(10)8(13)14/h5-6H,1-4,9-10H2,(H,11,12)(H,13,14)/i7+1,8+1 |
InChiKey: | InChIKey=ZTVZLYBCZNMWCF-BFGUONQLSA-N |
property |
|
Comments: | MASS SHIFT: M+2 WGK: 3 |
Information: | ISOTOPIC PURITY: 99 ATOM % 13C MW: 270.34 BY ATOM % CALCULATION |
secure_info |
* If the product has intellectual property rights, a license granted is must or contact us.