* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | D-GLUTAMIC ACID-5-13C |
EnglishSynonyms: | D-GLUTAMIC ACID-5-13C |
pro_mdlNumber: | MFCD04118178 |
pro_acceptors: | 5 |
pro_donors: | 3 |
pro_smile: | C(C[13C](=O)O)[C@H](C(=O)O)N |
InChi: | InChI=1S/C5H9NO4/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H,7,8)(H,9,10)/t3-/m1/s1/i4+1 |
InChiKey: | InChIKey=WHUUTDBJXJRKMK-AVODWXSXSA-N |
property |
|
MeltingPoint: | 205 DEG C (DEC)(LIT) |
Comments: | MASS SHIFT: M+1 OPTICAL ACTIVITY: [ALPHA]25/D -31.0 DEG, C = 2 IN 5 M HCL WGK: 3 |
Information: | ISOTOPIC PURITY: 99 ATOM % 13C MW: 148.12 BY ATOM % CALCULATION |
secure_info |
* If the product has intellectual property rights, a license granted is must or contact us.