* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | DICYANODIAMIDE-15N4 |
| EnglishSynonyms: | DICYANODIAMIDE-15N4 |
| pro_mdlNumber: | MFCD04118234 |
| pro_acceptors: | 4 |
| pro_donors: | 2 |
| pro_smile: | C(#[15N])[15NH][15NH]C#[15N] |
| InChi: | InChI=1S/C2H2N4/c3-1-5-6-2-4/h5-6H/i3+1,4+1,5+1,6+1 |
| InChiKey: | InChIKey=QVNJUFBAXGKRJY-PQVJJBODSA-N |
|
|
| Comments: | MASS SHIFT: M+4 WGK: 1 |
| Information: | ISOTOPIC PURITY: 98 ATOM % 15N MW: 87.98 BY ATOM % CALCULATION |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.