* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | DL-ISOPROPYLIDENEGLYCEROL-1,1,2,3,3-D5 |
| EnglishSynonyms: | DL-ISOPROPYLIDENEGLYCEROL-1,1,2,3,3-D5 |
| pro_mdlNumber: | MFCD04118261 |
| pro_acceptors: | 3 |
| pro_donors: | 1 |
| pro_smile: | [2H]C1(C(OC(O1)(C)C)([2H])C([2H])([2H])O)[2H] |
| InChiKey: | InChIKey=null |
|
|
| Boiling_Point: | 188-189 DEG C |
| Density: | DENSITY: 1.103 G/ML AT 25 DEG C |
| Comments: | ASSAY METHOD: CP MASS SHIFT: M+5 |
| Information: | ISOTOPIC PURITY: 98 ATOM % D MW: 137.10 BY ATOM % CALCULATION |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.