* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | D-LACTOSE-1-13C |
| EnglishSynonyms: | D-LACTOSE-1-13C |
| pro_mdlNumber: | MFCD05664357 |
| pro_acceptors: | 11 |
| pro_donors: | 8 |
| pro_smile: | C([C@@H]1[C@@H]([C@@H]([C@H]([C@@H](O1)O[C@@H]2[C@H](O[13CH]([C@@H]([C@H]2O)O)O)CO)O)O)O)O |
| InChi: | InChI=1S/C12H22O11/c13-1-3-5(15)6(16)9(19)12(22-3)23-10-4(2-14)21-11(20)8(18)7(10)17/h3-20H,1-2H2/t3-,4-,5+,6+,7-,8-,9-,10-,11?,12+/m1/s1/i11+1 |
| InChiKey: | InChIKey=GUBGYTABKSRVRQ-OUDYAVHASA-N |
|
|
| MeltingPoint: | 219 DEG C (DEC)(LIT) |
| Comments: | MASS SHIFT: M+1 OPTICAL ACTIVITY: [ALPHA]25/D +52.0 DEG, C = 2 IN H2O (TRACE NH4OH) UNSPSC: 12142200 WGK: 3 |
| Information: | ISOTOPIC PURITY: 99 ATOM % 13C MW: 343.30 BY ATOM % CALCULATION |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.