* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | VU0240551 |
| CAS: | 893990-34-6 |
| EnglishSynonyms: | N-(4-METHYL-1,3-THIAZOL-2-YL)-2-[(6-PHENYLPYRIDAZIN-3-YL)THIO]ACETAMIDE ; VU0240551 ; N-(4-METHYL-2-THIAZOLYL)-2-[(6-PHENYL-3-PYRIDAZINYL)THIO]-ACETAMIDE ; VU0240551-1 ; VU0240551-2-D4 |
| pro_mdlNumber: | MFCD05957363 |
| pro_acceptors: | 5 |
| pro_donors: | 1 |
| pro_smile: | Cc1csc(n1)NC(=O)CSc2ccc(nn2)c3ccccc3 |
| InChi: | InChI=1S/C16H14N4OS2/c1-11-9-23-16(17-11)18-14(21)10-22-15-8-7-13(19-20-15)12-5-3-2-4-6-12/h2-9H,10H2,1H3,(H,17,18,21) |
| InChiKey: | InChIKey=WJRWSLORVIHRNX-UHFFFAOYSA-N |
|
|
|
|
| secure_wgk_germany: | 3 |
* If the product has intellectual property rights, a license granted is must or contact us.