* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BE 1177 |
| EnglishSynonyms: | RARECHEM AL BE 1177 |
| pro_mdlNumber: | MFCD06203501 |
| pro_acceptors: | 12 |
| pro_donors: | 2 |
| pro_smile: | c1cc(c(cc1C(=O)O)[N+](=O)[O-])N2CCN(CC2)c3ccc(cc3[N+](=O)[O-])C(=O)O |
| InChi: | InChI=1S/C18H16N4O8/c23-17(24)11-1-3-13(15(9-11)21(27)28)19-5-7-20(8-6-19)14-4-2-12(18(25)26)10-16(14)22(29)30/h1-4,9-10H,5-8H2,(H,23,24)(H,25,26) |
| InChiKey: | InChIKey=OMVNWZWFWZUTBE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.