* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BE 1419 |
| EnglishSynonyms: | RARECHEM AL BE 1419 |
| pro_mdlNumber: | MFCD06203606 |
| pro_acceptors: | 9 |
| pro_donors: | 3 |
| pro_smile: | c1cc(c(cc1C(=O)O)C(C(=O)O)C(=O)O)[N+](=O)[O-] |
| InChi: | InChI=1S/C10H7NO8/c12-8(13)4-1-2-6(11(18)19)5(3-4)7(9(14)15)10(16)17/h1-3,7H,(H,12,13)(H,14,15)(H,16,17) |
| InChiKey: | InChIKey=XWSPWAOPHGBHMB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.