* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BF 1156 |
| EnglishSynonyms: | RARECHEM AL BF 1156 |
| pro_mdlNumber: | MFCD06204062 |
| pro_acceptors: | 5 |
| pro_donors: | 0 |
| pro_smile: | CC(C)(C)S(=O)(=O)/C(=C/c1c(ccs1)C(=O)OC)/C#N |
| InChi: | InChI=1S/C13H15NO4S2/c1-13(2,3)20(16,17)9(8-14)7-11-10(5-6-19-11)12(15)18-4/h5-7H,1-4H3/b9-7+ |
| InChiKey: | InChIKey=KNNJHQWTJBOXRY-VQHVLOKHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.