* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BF 1179 |
| EnglishSynonyms: | RARECHEM AL BF 1179 |
| pro_mdlNumber: | MFCD06204083 |
| pro_acceptors: | 4 |
| pro_donors: | 1 |
| pro_smile: | CCc1[nH]c(cn1)C(=O)OC |
| InChi: | InChI=1S/C7H10N2O2/c1-3-6-8-4-5(9-6)7(10)11-2/h4H,3H2,1-2H3,(H,8,9) |
| InChiKey: | InChIKey=YCTVWHJUXDNIDD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.