* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BF 1427 |
| EnglishSynonyms: | RARECHEM AL BF 1427 |
| pro_mdlNumber: | MFCD06204231 |
| pro_acceptors: | 3 |
| pro_donors: | 1 |
| pro_smile: | COC(=O)c1cc(cc(c1O)Br)C(F)(F)F |
| InChi: | InChI=1S/C9H6BrF3O3/c1-16-8(15)5-2-4(9(11,12)13)3-6(10)7(5)14/h2-3,14H,1H3 |
| InChiKey: | InChIKey=ZXSWCSPEOGJNBF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.