* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BI 0262 |
| EnglishSynonyms: | RARECHEM AL BI 0262 |
| pro_mdlNumber: | MFCD06204369 |
| pro_acceptors: | 2 |
| pro_donors: | 0 |
| pro_smile: | CC/C=C\CCCCCCC(=O)OCC |
| InChi: | InChI=1S/C13H24O2/c1-3-5-6-7-8-9-10-11-12-13(14)15-4-2/h5-6H,3-4,7-12H2,1-2H3/b6-5- |
| InChiKey: | InChIKey=PDTCGGWWKACZLF-WAYWQWQTSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.