* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | RARECHEM AL BI 0907 |
EnglishSynonyms: | RARECHEM AL BI 0907 |
pro_mdlNumber: | MFCD06204781 |
pro_acceptors: | 4 |
pro_donors: | 1 |
pro_smile: | CCOC(=O)c1ccc(c(c1Cl)O)OC |
InChi: | InChI=1S/C10H11ClO4/c1-3-15-10(13)6-4-5-7(14-2)9(12)8(6)11/h4-5,12H,3H2,1-2H3 |
InChiKey: | InChIKey=IKHNTCVYPVAKDC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.