* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | RARECHEM AL BI 1120 |
EnglishSynonyms: | RARECHEM AL BI 1120 |
pro_mdlNumber: | MFCD06204951 |
pro_acceptors: | 6 |
pro_donors: | 1 |
pro_smile: | CCOC(=O)/C(=C\O)/c1ccccc1[N+](=O)[O-] |
InChi: | InChI=1S/C11H11NO5/c1-2-17-11(14)9(7-13)8-5-3-4-6-10(8)12(15)16/h3-7,13H,2H2,1H3/b9-7- |
InChiKey: | InChIKey=WBKBCYROBHDYTK-CLFYSBASSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.