* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BK 0777 |
| EnglishSynonyms: | RARECHEM AL BK 0777 |
| pro_mdlNumber: | MFCD06205429 |
| pro_acceptors: | 5 |
| pro_donors: | 2 |
| pro_smile: | Cc1cc2c(cc1C)oc(c(c2=O)/C=C/C(=O)O)N |
| InChi: | InChI=1S/C14H13NO4/c1-7-5-10-11(6-8(7)2)19-14(15)9(13(10)18)3-4-12(16)17/h3-6H,15H2,1-2H3,(H,16,17)/b4-3+ |
| InChiKey: | InChIKey=HKGGGPFNEZHVNC-ONEGZZNKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.