* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BK 0778 |
| EnglishSynonyms: | RARECHEM AL BK 0778 |
| pro_mdlNumber: | MFCD06205430 |
| pro_acceptors: | 5 |
| pro_donors: | 2 |
| pro_smile: | c1ccc(cc1)COc2cc3c(c[nH]c3cn2)/C=C/C(=O)O |
| InChi: | InChI=1S/C17H14N2O3/c20-17(21)7-6-13-9-18-15-10-19-16(8-14(13)15)22-11-12-4-2-1-3-5-12/h1-10,18H,11H2,(H,20,21)/b7-6+ |
| InChiKey: | InChIKey=SKOVMSFUDBKURC-VOTSOKGWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.