* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | RARECHEM AL BK 0863 |
EnglishSynonyms: | RARECHEM AL BK 0863 |
pro_mdlNumber: | MFCD06205459 |
pro_acceptors: | 4 |
pro_donors: | 2 |
pro_smile: | c1cc(sc1/C=C/C(=O)O)c2ccc(s2)c3ccc(s3)/C=C/C(=O)O |
InChi: | InChI=1S/C18H12O4S3/c19-17(20)9-3-11-1-5-13(23-11)15-7-8-16(25-15)14-6-2-12(24-14)4-10-18(21)22/h1-10H,(H,19,20)(H,21,22)/b9-3+,10-4+ |
InChiKey: | InChIKey=NOEPEGKVEHGYOP-LQIBPGRFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.