* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | RARECHEM AL BK 1058 |
EnglishSynonyms: | RARECHEM AL BK 1058 |
pro_mdlNumber: | MFCD06205569 |
pro_acceptors: | 5 |
pro_donors: | 1 |
pro_smile: | CCOC(=O)c1c(n(c(c1/C=C/C(=O)O)C)c2ccccc2)C |
InChi: | InChI=1S/C18H19NO4/c1-4-23-18(22)17-13(3)19(14-8-6-5-7-9-14)12(2)15(17)10-11-16(20)21/h5-11H,4H2,1-3H3,(H,20,21)/b11-10+ |
InChiKey: | InChIKey=LEEMNOIXCCFYMJ-ZHACJKMWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.