* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | RARECHEM AL BL 0506 |
EnglishSynonyms: | RARECHEM AL BL 0506 |
pro_mdlNumber: | MFCD06206155 |
pro_acceptors: | 4 |
pro_donors: | 2 |
pro_smile: | c1cc(c(cc1Cl)C(CC(=O)O)N)OC(F)F |
InChi: | InChI=1S/C10H10ClF2NO3/c11-5-1-2-8(17-10(12)13)6(3-5)7(14)4-9(15)16/h1-3,7,10H,4,14H2,(H,15,16) |
InChiKey: | InChIKey=UXVXBRWBASNXAW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.