* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | RARECHEM AL BL 0546 |
EnglishSynonyms: | RARECHEM AL BL 0546 |
pro_mdlNumber: | MFCD06206179 |
pro_acceptors: | 3 |
pro_donors: | 2 |
pro_smile: | CC(C)(C)c1cc(cc(c1)C(C)(C)C)C(CC(=O)O)N |
InChi: | InChI=1S/C17H27NO2/c1-16(2,3)12-7-11(14(18)10-15(19)20)8-13(9-12)17(4,5)6/h7-9,14H,10,18H2,1-6H3,(H,19,20) |
InChiKey: | InChIKey=QXWZWNFDBXDIKA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.