* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | RARECHEM AL BL 0564 |
EnglishSynonyms: | RARECHEM AL BL 0564 |
pro_mdlNumber: | MFCD06206194 |
pro_acceptors: | 3 |
pro_donors: | 2 |
pro_smile: | c1ccc(cc1)/C=C(\C(CC(=O)O)N)/Cl |
InChi: | InChI=1S/C11H12ClNO2/c12-9(10(13)7-11(14)15)6-8-4-2-1-3-5-8/h1-6,10H,7,13H2,(H,14,15)/b9-6+ |
InChiKey: | InChIKey=RMTOOWJQCDAMQW-RMKNXTFCSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.