* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BL 0577 |
| EnglishSynonyms: | RARECHEM AL BL 0577 |
| pro_mdlNumber: | MFCD06206204 |
| pro_acceptors: | 5 |
| pro_donors: | 3 |
| pro_smile: | CC1(CCN2CCC(c3c2c1cc(c3O)C(CC(=O)O)N)(C)C)C |
| InChi: | InChI=1S/C19H28N2O3/c1-18(2)5-7-21-8-6-19(3,4)15-16(21)12(18)9-11(17(15)24)13(20)10-14(22)23/h9,13,24H,5-8,10,20H2,1-4H3,(H,22,23) |
| InChiKey: | InChIKey=QPNIYFNSTMJAIS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.