* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BL 0579 |
| EnglishSynonyms: | RARECHEM AL BL 0579 |
| pro_mdlNumber: | MFCD06206206 |
| pro_acceptors: | 5 |
| pro_donors: | 2 |
| pro_smile: | CCCCCCCCCCOc1ccc(cc1OCCCCCCCCCC)C(CC(=O)O)N |
| InChi: | InChI=1S/C29H51NO4/c1-3-5-7-9-11-13-15-17-21-33-27-20-19-25(26(30)24-29(31)32)23-28(27)34-22-18-16-14-12-10-8-6-4-2/h19-20,23,26H,3-18,21-22,24,30H2,1-2H3,(H,31,32) |
| InChiKey: | InChIKey=QYFPZWUZSWGAIZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.