* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | RARECHEM AL BL 0754 |
EnglishSynonyms: | RARECHEM AL BL 0754 |
pro_mdlNumber: | MFCD06206332 |
pro_acceptors: | 5 |
pro_donors: | 2 |
pro_smile: | COc1cccc(c1OCc2ccccc2)C(CC(=O)O)N |
InChi: | InChI=1S/C17H19NO4/c1-21-15-9-5-8-13(14(18)10-16(19)20)17(15)22-11-12-6-3-2-4-7-12/h2-9,14H,10-11,18H2,1H3,(H,19,20) |
InChiKey: | InChIKey=ZVTPUUNVWXPCDI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.