* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BL 0807 |
| EnglishSynonyms: | RARECHEM AL BL 0807 |
| pro_mdlNumber: | MFCD06206377 |
| pro_acceptors: | 7 |
| pro_donors: | 5 |
| pro_smile: | CC(C)(C)c1cc(c(c(c1)C(CC(=O)O)N)O)C(CC(=O)O)N |
| InChi: | InChI=1S/C16H24N2O5/c1-16(2,3)8-4-9(11(17)6-13(19)20)15(23)10(5-8)12(18)7-14(21)22/h4-5,11-12,23H,6-7,17-18H2,1-3H3,(H,19,20)(H,21,22) |
| InChiKey: | InChIKey=QRSLPKIHOWMNDY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.