* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BL 0845 |
| EnglishSynonyms: | RARECHEM AL BL 0845 |
| pro_mdlNumber: | MFCD06206387 |
| pro_acceptors: | 8 |
| pro_donors: | 4 |
| pro_smile: | CCCCCCCCOc1cc(c(cc1C(CC(=O)O)N)OCCCCCCCC)C(CC(=O)O)N |
| InChi: | InChI=1S/C28H48N2O6/c1-3-5-7-9-11-13-15-35-25-17-22(24(30)20-28(33)34)26(18-21(25)23(29)19-27(31)32)36-16-14-12-10-8-6-4-2/h17-18,23-24H,3-16,19-20,29-30H2,1-2H3,(H,31,32)(H,33,34) |
| InChiKey: | InChIKey=XTGCMPRZUTXRQX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.