* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BL 0857 |
| EnglishSynonyms: | RARECHEM AL BL 0857 |
| pro_mdlNumber: | MFCD06206398 |
| pro_acceptors: | 4 |
| pro_donors: | 2 |
| pro_smile: | CC(C)(C)c1cc(c(c(c1)C(C)(C)C)OC)C(CC(=O)O)N |
| InChi: | InChI=1S/C18H29NO3/c1-17(2,3)11-8-12(14(19)10-15(20)21)16(22-7)13(9-11)18(4,5)6/h8-9,14H,10,19H2,1-7H3,(H,20,21) |
| InChiKey: | InChIKey=YWIWNFRBQXWEKQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.