* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | RARECHEM AL BM 0068 |
EnglishSynonyms: | RARECHEM AL BM 0068 |
pro_mdlNumber: | MFCD06207011 |
pro_acceptors: | 4 |
pro_donors: | 2 |
pro_smile: | C/C(=C\c1ccc(c(c1)O)OC)/C(=O)O |
InChi: | InChI=1S/C11H12O4/c1-7(11(13)14)5-8-3-4-10(15-2)9(12)6-8/h3-6,12H,1-2H3,(H,13,14)/b7-5+ |
InChiKey: | InChIKey=UHHYMEKJVCRYFK-FNORWQNLSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.