* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | RARECHEM AL BM 0094 |
EnglishSynonyms: | RARECHEM AL BM 0094 |
pro_mdlNumber: | MFCD06207032 |
pro_acceptors: | 2 |
pro_donors: | 1 |
pro_smile: | C/C(=C\c1ccc2ccccc2c1)/C(=O)O |
InChi: | InChI=1S/C14H12O2/c1-10(14(15)16)8-11-6-7-12-4-2-3-5-13(12)9-11/h2-9H,1H3,(H,15,16)/b10-8+ |
InChiKey: | InChIKey=MYISLTDGMMRXAN-CSKARUKUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.