* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | RARECHEM AL BM 0282 |
EnglishSynonyms: | RARECHEM AL BM 0282 |
pro_mdlNumber: | MFCD06207146 |
pro_acceptors: | 3 |
pro_donors: | 1 |
pro_smile: | C/C(=C\c1ccccc1OC(F)(F)F)/C(=O)O |
InChi: | InChI=1S/C11H9F3O3/c1-7(10(15)16)6-8-4-2-3-5-9(8)17-11(12,13)14/h2-6H,1H3,(H,15,16)/b7-6+ |
InChiKey: | InChIKey=JDOQLPUQURHDAN-VOTSOKGWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.