* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | RARECHEM AL BM 0291 |
EnglishSynonyms: | RARECHEM AL BM 0291 |
pro_mdlNumber: | MFCD06207153 |
pro_acceptors: | 3 |
pro_donors: | 1 |
pro_smile: | C/C(=C\c1ccc2c(c1)CCC(O2)(C)C)/C(=O)O |
InChi: | InChI=1S/C15H18O3/c1-10(14(16)17)8-11-4-5-13-12(9-11)6-7-15(2,3)18-13/h4-5,8-9H,6-7H2,1-3H3,(H,16,17)/b10-8+ |
InChiKey: | InChIKey=ZHKVHSZCXVLUGB-CSKARUKUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.